ChemNet > CAS > 69625-13-4 2-[4-(4-nitrofenyl)-1,3-thiazol-2-yl]acetonitril
69625-13-4 2-[4-(4-nitrofenyl)-1,3-thiazol-2-yl]acetonitril
| název výrobku |
2-[4-(4-nitrofenyl)-1,3-thiazol-2-yl]acetonitril |
| Synonyma |
[4-(4-nitrofenyl)-1,3-thiazol-2-yl]acetonitril |
| Anglický název |
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile;[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
| Molekulární vzorec |
C11H7N3O2S |
| Molekulová hmotnost |
245.2572 |
| InChI |
InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2 |
| Registrační číslo CAS |
69625-13-4 |
| Molekulární struktura |
|
| Hustota |
1.397g/cm3 |
| Bod tání |
147℃ |
| Bod varu |
457.3°C at 760 mmHg |
| Index lomu |
1.641 |
| Bod vzplanutí |
230.3°C |
| Tlak par |
1.51E-08mmHg at 25°C |
| Symbolů nebezpečnosti |
Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|